About 2-bromo-N-(3-methylbutyl)acetamide;1-iodo-2-methylpropane
2-bromo-N-(3-methylbutyl)acetamide;1-iodo-2-methylpropane (PubChem CID 157499049) has the molecular formula C11H23BrINO
and a molecular weight of 392.12 g/mol. Its IUPAC name is 2-bromo-N-(3-methylbutyl)acetamide;1-iodo-2-methylpropane.
Molecular Properties
| Compound Name | 2-bromo-N-(3-methylbutyl)acetamide;1-iodo-2-methylpropane |
| PubChem CID | 157499049 |
| Molecular Formula | C11H23BrINO |
| Molecular Weight | 392.12 g/mol |
| Exact Mass | 391.00 |
| IUPAC Name | 2-bromo-N-(3-methylbutyl)acetamide;1-iodo-2-methylpropane |
| SMILES | CC(C)CCNC(=O)CBr.CC(C)CI |
| InChI | InChI=1S/C7H14BrNO.C4H9I/c1-6(2)3-4-9-7(10)5-8;1-4(2)3-5/h6H,3-5H2,1-2H3,(H,9,10);4H,3H2,1-2H3 |
| InChIKey | BYELIJRIGIQNQW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.12 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-N-(3-methylbutyl)acetamide;1-iodo-2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-(3-methylbutyl)acetamide;1-iodo-2-methylpropane?
The IUPAC name of 2-bromo-N-(3-methylbutyl)acetamide;1-iodo-2-methylpropane (CID 157499049) is 2-bromo-N-(3-methylbutyl)acetamide;1-iodo-2-methylpropane.
What is the SMILES notation for 2-bromo-N-(3-methylbutyl)acetamide;1-iodo-2-methylpropane?
The canonical SMILES for 2-bromo-N-(3-methylbutyl)acetamide;1-iodo-2-methylpropane is CC(C)CCNC(=O)CBr.CC(C)CI.
What is the InChIKey of 2-bromo-N-(3-methylbutyl)acetamide;1-iodo-2-methylpropane?
The InChIKey is BYELIJRIGIQNQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14BrNO.C4H9I/c1-6(2)3-4-9-7(10)5-8;1-4(2)3-5/h6H,3-5H2,1-2H3,(H,9,10);4H,3H2,1-2H3.
What are the key properties of 2-bromo-N-(3-methylbutyl)acetamide;1-iodo-2-methylpropane?
2-bromo-N-(3-methylbutyl)acetamide;1-iodo-2-methylpropane has a molecular weight of 392.12 g/mol, XLogP of 3.62, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-(3-methylbutyl)acetamide;1-iodo-2-methylpropane is sourced from PubChem (CID 157499049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).