methyl 2,5-bis[(2-bromoacetyl)amino]pentanoate

C10H16Br2N2O4 — CID 144871728

IUPACmethyl 2,5-bis[(2-bromoacetyl)amino]pentanoate
SMILESCOC(=O)C(CCCNC(=O)CBr)NC(=O)CBr
InChIInChI=1S/C10H16Br2N2O4/c1-18-10(17)7(14-9(16)6-12)3-2-4-13-8(15)5-11/h7H,2-6H2,1H3,(H,13,15)(H,14,16)
InChIKeyGYTNUMGOWCHKRT-UHFFFAOYSA-N
MW388.06 g/mol
LogP0.33
Rot. Bonds8

About methyl 2,5-bis[(2-bromoacetyl)amino]pentanoate

methyl 2,5-bis[(2-bromoacetyl)amino]pentanoate (PubChem CID 144871728) has the molecular formula C10H16Br2N2O4 and a molecular weight of 388.06 g/mol. Its IUPAC name is methyl 2,5-bis[(2-bromoacetyl)amino]pentanoate.

Molecular Properties

Compound Namemethyl 2,5-bis[(2-bromoacetyl)amino]pentanoate
PubChem CID144871728
Molecular FormulaC10H16Br2N2O4
Molecular Weight388.06 g/mol
Exact Mass385.95
IUPAC Namemethyl 2,5-bis[(2-bromoacetyl)amino]pentanoate
SMILESCOC(=O)C(CCCNC(=O)CBr)NC(=O)CBr
InChIInChI=1S/C10H16Br2N2O4/c1-18-10(17)7(14-9(16)6-12)3-2-4-13-8(15)5-11/h7H,2-6H2,1H3,(H,13,15)(H,14,16)
InChIKeyGYTNUMGOWCHKRT-UHFFFAOYSA-N
XLogP0.33
TPSA84.50 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500388.06
LogP ≤ 50.33
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze methyl 2,5-bis[(2-bromoacetyl)amino]pentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2,5-bis[(2-bromoacetyl)amino]pentanoate?
The IUPAC name of methyl 2,5-bis[(2-bromoacetyl)amino]pentanoate (CID 144871728) is methyl 2,5-bis[(2-bromoacetyl)amino]pentanoate.
What is the SMILES notation for methyl 2,5-bis[(2-bromoacetyl)amino]pentanoate?
The canonical SMILES for methyl 2,5-bis[(2-bromoacetyl)amino]pentanoate is COC(=O)C(CCCNC(=O)CBr)NC(=O)CBr.
What is the InChIKey of methyl 2,5-bis[(2-bromoacetyl)amino]pentanoate?
The InChIKey is GYTNUMGOWCHKRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16Br2N2O4/c1-18-10(17)7(14-9(16)6-12)3-2-4-13-8(15)5-11/h7H,2-6H2,1H3,(H,13,15)(H,14,16).
What are the key properties of methyl 2,5-bis[(2-bromoacetyl)amino]pentanoate?
methyl 2,5-bis[(2-bromoacetyl)amino]pentanoate has a molecular weight of 388.06 g/mol, XLogP of 0.33, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,5-bis[(2-bromoacetyl)amino]pentanoate is sourced from PubChem (CID 144871728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).