C10H16Br2N2O4 — CID 144871728
methyl 2,5-bis[(2-bromoacetyl)amino]pentanoate (PubChem CID 144871728) has the molecular formula C10H16Br2N2O4 and a molecular weight of 388.06 g/mol. Its IUPAC name is methyl 2,5-bis[(2-bromoacetyl)amino]pentanoate.
| Compound Name | methyl 2,5-bis[(2-bromoacetyl)amino]pentanoate |
|---|---|
| PubChem CID | 144871728 |
| Molecular Formula | C10H16Br2N2O4 |
| Molecular Weight | 388.06 g/mol |
| Exact Mass | 385.95 |
| IUPAC Name | methyl 2,5-bis[(2-bromoacetyl)amino]pentanoate |
| SMILES | COC(=O)C(CCCNC(=O)CBr)NC(=O)CBr |
| InChI | InChI=1S/C10H16Br2N2O4/c1-18-10(17)7(14-9(16)6-12)3-2-4-13-8(15)5-11/h7H,2-6H2,1H3,(H,13,15)(H,14,16) |
| InChIKey | GYTNUMGOWCHKRT-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.06 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|