C13H24BrN5O4 — CID 155175640
2-[3-[(2-bromoacetyl)amino]propanoylamino]-5-[(N,N'-dimethylcarbamimidoyl)amino]pentanoic acid (PubChem CID 155175640) has the molecular formula C13H24BrN5O4 and a molecular weight of 394.27 g/mol. Its IUPAC name is 2-[3-[(2-bromoacetyl)amino]propanoylamino]-5-[(N,N'-dimethylcarbamimidoyl)amino]pentanoic acid.
| Compound Name | 2-[3-[(2-bromoacetyl)amino]propanoylamino]-5-[(N,N'-dimethylcarbamimidoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 155175640 |
| Molecular Formula | C13H24BrN5O4 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | 2-[3-[(2-bromoacetyl)amino]propanoylamino]-5-[(N,N'-dimethylcarbamimidoyl)amino]pentanoic acid |
| SMILES | C/N=C(\NC)NCCCC(NC(=O)CCNC(=O)CBr)C(=O)O |
| InChI | InChI=1S/C13H24BrN5O4/c1-15-13(16-2)18-6-3-4-9(12(22)23)19-10(20)5-7-17-11(21)8-14/h9H,3-8H2,1-2H3,(H,17,21)(H,19,20)(H,22,23)(H2,15,16,18) |
| InChIKey | JVFQMNGECCKGQB-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 131.92 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|