C10H17N3O6 — CID 170287274
(2S)-5-amino-2-[3-(methoxycarbonylamino)propanoylamino]-5-oxopentanoic acid (PubChem CID 170287274) has the molecular formula C10H17N3O6 and a molecular weight of 275.26 g/mol. Its IUPAC name is (2S)-5-amino-2-[3-(methoxycarbonylamino)propanoylamino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[3-(methoxycarbonylamino)propanoylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 170287274 |
| Molecular Formula | C10H17N3O6 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | (2S)-5-amino-2-[3-(methoxycarbonylamino)propanoylamino]-5-oxopentanoic acid |
| SMILES | COC(=O)NCCC(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C10H17N3O6/c1-19-10(18)12-5-4-8(15)13-6(9(16)17)2-3-7(11)14/h6H,2-5H2,1H3,(H2,11,14)(H,12,18)(H,13,15)(H,16,17)/t6-/m0/s1 |
| InChIKey | NAQJMBMKBGEGJL-LURJTMIESA-N |
| XLogP | -1.43 |
| TPSA | 147.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |