C9H20N4O — CID 170258094
5-[(N,N'-dimethylcarbamimidoyl)amino]-N-methylpentanamide (PubChem CID 170258094) has the molecular formula C9H20N4O and a molecular weight of 200.29 g/mol. Its IUPAC name is 5-[(N,N'-dimethylcarbamimidoyl)amino]-N-methylpentanamide.
| Compound Name | 5-[(N,N'-dimethylcarbamimidoyl)amino]-N-methylpentanamide |
|---|---|
| PubChem CID | 170258094 |
| Molecular Formula | C9H20N4O |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 5-[(N,N'-dimethylcarbamimidoyl)amino]-N-methylpentanamide |
| SMILES | C/N=C(\NC)NCCCCC(=O)NC |
| InChI | InChI=1S/C9H20N4O/c1-10-8(14)6-4-5-7-13-9(11-2)12-3/h4-7H2,1-3H3,(H,10,14)(H2,11,12,13) |
| InChIKey | PRCQVRNPMKJOMB-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|