C12H24N4O3 — CID 158304088
(2S)-2-(butanoylamino)-5-[(N,N'-dimethylcarbamimidoyl)amino]pentanoic acid (PubChem CID 158304088) has the molecular formula C12H24N4O3 and a molecular weight of 272.35 g/mol. Its IUPAC name is (2S)-2-(butanoylamino)-5-[(N,N'-dimethylcarbamimidoyl)amino]pentanoic acid.
| Compound Name | (2S)-2-(butanoylamino)-5-[(N,N'-dimethylcarbamimidoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 158304088 |
| Molecular Formula | C12H24N4O3 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | (2S)-2-(butanoylamino)-5-[(N,N'-dimethylcarbamimidoyl)amino]pentanoic acid |
| SMILES | CCCC(=O)N[C@@H](CCCN/C(=N/C)NC)C(=O)O |
| InChI | InChI=1S/C12H24N4O3/c1-4-6-10(17)16-9(11(18)19)7-5-8-15-12(13-2)14-3/h9H,4-8H2,1-3H3,(H,16,17)(H,18,19)(H2,13,14,15)/t9-/m0/s1 |
| InChIKey | JBNBVENXCCQONB-VIFPVBQESA-N |
| XLogP | -0.07 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|