C12H24N2O3S — CID 58895159
methyl (2S)-2-(methylamino)-6-(4-sulfanylbutanoylamino)hexanoate (PubChem CID 58895159) has the molecular formula C12H24N2O3S and a molecular weight of 276.40 g/mol. Its IUPAC name is methyl (2S)-2-(methylamino)-6-(4-sulfanylbutanoylamino)hexanoate.
| Compound Name | methyl (2S)-2-(methylamino)-6-(4-sulfanylbutanoylamino)hexanoate |
|---|---|
| PubChem CID | 58895159 |
| Molecular Formula | C12H24N2O3S |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | methyl (2S)-2-(methylamino)-6-(4-sulfanylbutanoylamino)hexanoate |
| SMILES | CN[C@@H](CCCCNC(=O)CCCS)C(=O)OC |
| InChI | InChI=1S/C12H24N2O3S/c1-13-10(12(16)17-2)6-3-4-8-14-11(15)7-5-9-18/h10,13,18H,3-9H2,1-2H3,(H,14,15)/t10-/m0/s1 |
| InChIKey | TZKRFLSSLOCVLX-JTQLQIEISA-N |
| XLogP | 0.74 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|