C20H40N4O5 — CID 58660988
[[6-(hexanoylamino)-1-methoxy-1-oxohexan-2-yl]amino] 6-amino-2-(methylamino)hexanoate (PubChem CID 58660988) has the molecular formula C20H40N4O5 and a molecular weight of 416.56 g/mol. Its IUPAC name is [[6-(hexanoylamino)-1-methoxy-1-oxohexan-2-yl]amino] 6-amino-2-(methylamino)hexanoate.
| Compound Name | [[6-(hexanoylamino)-1-methoxy-1-oxohexan-2-yl]amino] 6-amino-2-(methylamino)hexanoate |
|---|---|
| PubChem CID | 58660988 |
| Molecular Formula | C20H40N4O5 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.30 |
| IUPAC Name | [[6-(hexanoylamino)-1-methoxy-1-oxohexan-2-yl]amino] 6-amino-2-(methylamino)hexanoate |
| SMILES | CCCCCC(=O)NCCCCC(NOC(=O)C(CCCCN)NC)C(=O)OC |
| InChI | InChI=1S/C20H40N4O5/c1-4-5-6-13-18(25)23-15-10-8-12-17(19(26)28-3)24-29-20(27)16(22-2)11-7-9-14-21/h16-17,22,24H,4-15,21H2,1-3H3,(H,23,25) |
| InChIKey | QHNHDZDPGCWDKN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|