C10H22N3O3+ — CID 145125415
[(2S)-6-(3-aminopropanoylamino)-2-(methylamino)hexanoyl]oxidanium (PubChem CID 145125415) has the molecular formula C10H22N3O3+ and a molecular weight of 232.30 g/mol. Its IUPAC name is [(2S)-6-(3-aminopropanoylamino)-2-(methylamino)hexanoyl]oxidanium.
| Compound Name | [(2S)-6-(3-aminopropanoylamino)-2-(methylamino)hexanoyl]oxidanium |
|---|---|
| PubChem CID | 145125415 |
| Molecular Formula | C10H22N3O3+ |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | [(2S)-6-(3-aminopropanoylamino)-2-(methylamino)hexanoyl]oxidanium |
| SMILES | CN[C@@H](CCCCNC(=O)CCN)C(=O)[OH2+] |
| InChI | InChI=1S/C10H21N3O3/c1-12-8(10(15)16)4-2-3-7-13-9(14)5-6-11/h8,12H,2-7,11H2,1H3,(H,13,14)(H,15,16)/p+1/t8-/m0/s1 |
| InChIKey | YJCBVHQLDFLPOJ-QMMMGPOBSA-O |
| XLogP | -1.54 |
| TPSA | 107.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|