C15H28BrN3O3 — CID 90068818
N'-[5-[(2-bromoacetyl)amino]pentyl]-2-ethyl-4-methylpentanediamide (PubChem CID 90068818) has the molecular formula C15H28BrN3O3 and a molecular weight of 378.31 g/mol. Its IUPAC name is N'-[5-[(2-bromoacetyl)amino]pentyl]-2-ethyl-4-methylpentanediamide.
| Compound Name | N'-[5-[(2-bromoacetyl)amino]pentyl]-2-ethyl-4-methylpentanediamide |
|---|---|
| PubChem CID | 90068818 |
| Molecular Formula | C15H28BrN3O3 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | N'-[5-[(2-bromoacetyl)amino]pentyl]-2-ethyl-4-methylpentanediamide |
| SMILES | CCC(CC(C)C(=O)NCCCCCNC(=O)CBr)C(N)=O |
| InChI | InChI=1S/C15H28BrN3O3/c1-3-12(14(17)21)9-11(2)15(22)19-8-6-4-5-7-18-13(20)10-16/h11-12H,3-10H2,1-2H3,(H2,17,21)(H,18,20)(H,19,22) |
| InChIKey | USZJPRYGWCITHO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|