C19H43N3O2 — CID 160939123
azane;N'-decyl-2-ethyl-4-methylpentanediamide;methane (PubChem CID 160939123) has the molecular formula C19H43N3O2 and a molecular weight of 345.57 g/mol. Its IUPAC name is azane;N'-decyl-2-ethyl-4-methylpentanediamide;methane.
| Compound Name | azane;N'-decyl-2-ethyl-4-methylpentanediamide;methane |
|---|---|
| PubChem CID | 160939123 |
| Molecular Formula | C19H43N3O2 |
| Molecular Weight | 345.57 g/mol |
| Exact Mass | 345.34 |
| IUPAC Name | azane;N'-decyl-2-ethyl-4-methylpentanediamide;methane |
| SMILES | C.CCCCCCCCCCNC(=O)C(C)CC(CC)C(N)=O.N |
| InChI | InChI=1S/C18H36N2O2.CH4.H3N/c1-4-6-7-8-9-10-11-12-13-20-18(22)15(3)14-16(5-2)17(19)21;;/h15-16H,4-14H2,1-3H3,(H2,19,21)(H,20,22);1H4;1H3 |
| InChIKey | LBWYRLGAZCVKKL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 107.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.57 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|