C12H21N3O3 — CID 170272651
2-methyl-6-[3-(3-methyldiazirin-3-yl)propanoylamino]hexanoic acid (PubChem CID 170272651) has the molecular formula C12H21N3O3 and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-methyl-6-[3-(3-methyldiazirin-3-yl)propanoylamino]hexanoic acid.
| Compound Name | 2-methyl-6-[3-(3-methyldiazirin-3-yl)propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 170272651 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 2-methyl-6-[3-(3-methyldiazirin-3-yl)propanoylamino]hexanoic acid |
| SMILES | CC(CCCCNC(=O)CCC1(C)N=N1)C(=O)O |
| InChI | InChI=1S/C12H21N3O3/c1-9(11(17)18)5-3-4-8-13-10(16)6-7-12(2)14-15-12/h9H,3-8H2,1-2H3,(H,13,16)(H,17,18) |
| InChIKey | VZDWBBIDTKOTRI-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|