C21H40N6O10 — CID 171621767
6-[2-[(5-amino-5-oxopentanoyl)amino]ethylcarbamoylamino]-2-methylhexanoic acid;pentanedioic acid;urea (PubChem CID 171621767) has the molecular formula C21H40N6O10 and a molecular weight of 536.58 g/mol. Its IUPAC name is 6-[2-[(5-amino-5-oxopentanoyl)amino]ethylcarbamoylamino]-2-methylhexanoic acid;pentanedioic acid;urea.
| Compound Name | 6-[2-[(5-amino-5-oxopentanoyl)amino]ethylcarbamoylamino]-2-methylhexanoic acid;pentanedioic acid;urea |
|---|---|
| PubChem CID | 171621767 |
| Molecular Formula | C21H40N6O10 |
| Molecular Weight | 536.58 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | 6-[2-[(5-amino-5-oxopentanoyl)amino]ethylcarbamoylamino]-2-methylhexanoic acid;pentanedioic acid;urea |
| SMILES | CC(CCCCNC(=O)NCCNC(=O)CCCC(N)=O)C(=O)O.NC(N)=O.O=C(O)CCCC(=O)O |
| InChI | InChI=1S/C15H28N4O5.C5H8O4.CH4N2O/c1-11(14(22)23)5-2-3-8-18-15(24)19-10-9-17-13(21)7-4-6-12(16)20;6-4(7)2-1-3-5(8)9;2-1(3)4/h11H,2-10H2,1H3,(H2,16,20)(H,17,21)(H,22,23)(H2,18,19,24);1-3H2,(H,6,7)(H,8,9);(H4,2,3,4) |
| InChIKey | FNYNQCVRDAUARE-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 294.33 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.58 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|