C12H24ClN5O3 — CID 171324498
2-amino-6-[3-(3-methyldiazirin-3-yl)propylcarbamoylamino]hexanoic acid;hydrochloride (PubChem CID 171324498) has the molecular formula C12H24ClN5O3 and a molecular weight of 321.81 g/mol. Its IUPAC name is 2-amino-6-[3-(3-methyldiazirin-3-yl)propylcarbamoylamino]hexanoic acid;hydrochloride.
| Compound Name | 2-amino-6-[3-(3-methyldiazirin-3-yl)propylcarbamoylamino]hexanoic acid;hydrochloride |
|---|---|
| PubChem CID | 171324498 |
| Molecular Formula | C12H24ClN5O3 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 2-amino-6-[3-(3-methyldiazirin-3-yl)propylcarbamoylamino]hexanoic acid;hydrochloride |
| SMILES | CC1(CCCNC(=O)NCCCCC(N)C(=O)O)N=N1.Cl |
| InChI | InChI=1S/C12H23N5O3.ClH/c1-12(16-17-12)6-4-8-15-11(20)14-7-3-2-5-9(13)10(18)19;/h9H,2-8,13H2,1H3,(H,18,19)(H2,14,15,20);1H |
| InChIKey | SMAFSXMDCAPICY-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 129.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|