C8H19AcCl2N3O3 — CID 172932438
actinium;(2S)-2-amino-6-[[(E)-N-hydroxy-C-methylcarbonimidoyl]amino]hexanoic acid;dihydrochloride (PubChem CID 172932438) has the molecular formula C8H19AcCl2N3O3 and a molecular weight of 503.16 g/mol. Its IUPAC name is actinium;(2S)-2-amino-6-[[(E)-N-hydroxy-C-methylcarbonimidoyl]amino]hexanoic acid;dihydrochloride.
| Compound Name | actinium;(2S)-2-amino-6-[[(E)-N-hydroxy-C-methylcarbonimidoyl]amino]hexanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 172932438 |
| Molecular Formula | C8H19AcCl2N3O3 |
| Molecular Weight | 503.16 g/mol |
| Exact Mass | 502.11 |
| IUPAC Name | actinium;(2S)-2-amino-6-[[(E)-N-hydroxy-C-methylcarbonimidoyl]amino]hexanoic acid;dihydrochloride |
| SMILES | C/C(=N\O)NCCCC[C@H](N)C(=O)O.Cl.Cl.[Ac] |
| InChI | InChI=1S/C8H17N3O3.Ac.2ClH/c1-6(11-14)10-5-3-2-4-7(9)8(12)13;;;/h7,14H,2-5,9H2,1H3,(H,10,11)(H,12,13);;2*1H/t7-;;;/m0.../s1 |
| InChIKey | PKRLQVXCLSOHNO-QTPLPEIMSA-N |
| XLogP | 0.81 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.16 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|