C8H16N2O3S — CID 134355075
2-amino-6-(methylsulfanylcarbonylamino)hexanoic acid (PubChem CID 134355075) has the molecular formula C8H16N2O3S and a molecular weight of 220.29 g/mol. Its IUPAC name is 2-amino-6-(methylsulfanylcarbonylamino)hexanoic acid.
| Compound Name | 2-amino-6-(methylsulfanylcarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 134355075 |
| Molecular Formula | C8H16N2O3S |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.09 |
| IUPAC Name | 2-amino-6-(methylsulfanylcarbonylamino)hexanoic acid |
| SMILES | CSC(=O)NCCCCC(N)C(=O)O |
| InChI | InChI=1S/C8H16N2O3S/c1-14-8(13)10-5-3-2-4-6(9)7(11)12/h6H,2-5,9H2,1H3,(H,10,13)(H,11,12) |
| InChIKey | YULQPTPPALJPPJ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|