C36H66N10O8 — CID 170903639
N-[6-[2-[(2-aminooxyacetyl)amino]ethylamino]-6-oxohexyl]-N'-[5-[6-[6-[3-(3-methyldiazirin-3-yl)propanoylamino]hexanoylamino]hexanoylamino]pentyl]butanediamide (PubChem CID 170903639) has the molecular formula C36H66N10O8 and a molecular weight of 766.99 g/mol. Its IUPAC name is N-[6-[2-[(2-aminooxyacetyl)amino]ethylamino]-6-oxohexyl]-N'-[5-[6-[6-[3-(3-methyldiazirin-3-yl)propanoylamino]hexanoylamino]hexanoylamino]pentyl]butanediamide.
| Compound Name | N-[6-[2-[(2-aminooxyacetyl)amino]ethylamino]-6-oxohexyl]-N'-[5-[6-[6-[3-(3-methyldiazirin-3-yl)propanoylamino]hexanoylamino]hexanoylamino]pentyl]butanediamide |
|---|---|
| PubChem CID | 170903639 |
| Molecular Formula | C36H66N10O8 |
| Molecular Weight | 766.99 g/mol |
| Exact Mass | 766.51 |
| IUPAC Name | N-[6-[2-[(2-aminooxyacetyl)amino]ethylamino]-6-oxohexyl]-N'-[5-[6-[6-[3-(3-methyldiazirin-3-yl)propanoylamino]hexanoylamino]hexanoylamino]pentyl]butanediamide |
| SMILES | CC1(CCC(=O)NCCCCCC(=O)NCCCCCC(=O)NCCCCCNC(=O)CCC(=O)NCCCCCC(=O)NCCNC(=O)CON)N=N1 |
| InChI | InChI=1S/C36H66N10O8/c1-36(45-46-36)20-19-34(52)42-23-11-3-7-14-29(47)38-21-9-2-6-15-30(48)39-24-12-5-13-25-41-33(51)18-17-32(50)40-22-10-4-8-16-31(49)43-26-27-44-35(53)28-54-37/h2-28,37H2,1H3,(H,38,47)(H,39,48)(H,40,50)(H,41,51)(H,42,52)(H,43,49)(H,44,53) |
| InChIKey | NJVUQYYKOBCSIV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 263.67 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.99 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|