C18H36N4O4 — CID 143730813
acetamide;N,N-bis[2-(butylamino)-2-oxoethyl]butanamide (PubChem CID 143730813) has the molecular formula C18H36N4O4 and a molecular weight of 372.51 g/mol. Its IUPAC name is acetamide;N,N-bis[2-(butylamino)-2-oxoethyl]butanamide.
| Compound Name | acetamide;N,N-bis[2-(butylamino)-2-oxoethyl]butanamide |
|---|---|
| PubChem CID | 143730813 |
| Molecular Formula | C18H36N4O4 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | acetamide;N,N-bis[2-(butylamino)-2-oxoethyl]butanamide |
| SMILES | CC(N)=O.CCCCNC(=O)CN(CC(=O)NCCCC)C(=O)CCC |
| InChI | InChI=1S/C16H31N3O3.C2H5NO/c1-4-7-10-17-14(20)12-19(16(22)9-6-3)13-15(21)18-11-8-5-2;1-2(3)4/h4-13H2,1-3H3,(H,17,20)(H,18,21);1H3,(H2,3,4) |
| InChIKey | REGFIKXMAWFXMB-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 121.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|