C62H112N16O16 — CID 91281106
(2S)-6-[[2-[[2-[[(5S)-6-amino-5-methyl-6-oxohexyl]amino]-2-oxoethyl]-[3-[[(2S)-2,6-diacetamidohexanoyl]amino]propanoyl]amino]acetyl]amino]-2-methylhexanamide (PubChem CID 91281106) has the molecular formula C62H112N16O16 and a molecular weight of 1337.67 g/mol. Its IUPAC name is (2S)-6-[[2-[[2-[[(5S)-6-amino-5-methyl-6-oxohexyl]amino]-2-oxoethyl]-[3-[[(2S)-2,6-diacetamidohexanoyl]amino]propanoyl]amino]acetyl]amino]-2-methylhexanamide.
| Compound Name | (2S)-6-[[2-[[2-[[(5S)-6-amino-5-methyl-6-oxohexyl]amino]-2-oxoethyl]-[3-[[(2S)-2,6-diacetamidohexanoyl]amino]propanoyl]amino]acetyl]amino]-2-methylhexanamide |
|---|---|
| PubChem CID | 91281106 |
| Molecular Formula | C62H112N16O16 |
| Molecular Weight | 1337.67 g/mol |
| Exact Mass | 1336.84 |
| IUPAC Name | (2S)-6-[[2-[[2-[[(5S)-6-amino-5-methyl-6-oxohexyl]amino]-2-oxoethyl]-[3-[[(2S)-2,6-diacetamidohexanoyl]amino]propanoyl]amino]acetyl]amino]-2-methylhexanamide |
| SMILES | CC(=O)NCCCC[C@H](NC(C)=O)C(=O)NCCC(=O)N(CC(=O)NCCCC[C@H](C)C(N)=O)CC(=O)NCCCC[C@H](C)C(N)=O.CC(=O)NCCCC[C@H](NC(C)=O)C(=O)NCCC(=O)N(CC(=O)NCCCC[C@H](C)C(N)=O)CC(=O)NCCCC[C@H](C)C(N)=O |
| InChI | InChI=1S/2C31H56N8O8/c2*1-21(29(32)45)11-5-8-16-35-26(42)19-39(20-27(43)36-17-9-6-12-22(2)30(33)46)28(44)14-18-37-31(47)25(38-24(4)41)13-7-10-15-34-23(3)40/h2*21-22,25H,5-20H2,1-4H3,(H2,32,45)(H2,33,46)(H,34,40)(H,35,42)(H,36,43)(H,37,47)(H,38,41)/t2*21-,22-,25-/m00/s1 |
| InChIKey | KNZKVYISHSREKS-FMCFSCCZSA-N |
| XLogP | -2.10 |
| TPSA | 503.98 Ų |
| H-Bond Donors | 14 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 94 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1337.67 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 14 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|