C62H112N16O20 — CID 158005504
methyl N-[(2S)-1-[[3-[bis[2-[(6-amino-5-methyl-6-oxohexyl)amino]-2-oxoethyl]amino]-3-oxopropyl]amino]-6-(methoxycarbonylamino)-1-oxohexan-2-yl]carbamate (PubChem CID 158005504) has the molecular formula C62H112N16O20 and a molecular weight of 1401.67 g/mol. Its IUPAC name is methyl N-[(2S)-1-[[3-[bis[2-[(6-amino-5-methyl-6-oxohexyl)amino]-2-oxoethyl]amino]-3-oxopropyl]amino]-6-(methoxycarbonylamino)-1-oxohexan-2-yl]carbamate.
| Compound Name | methyl N-[(2S)-1-[[3-[bis[2-[(6-amino-5-methyl-6-oxohexyl)amino]-2-oxoethyl]amino]-3-oxopropyl]amino]-6-(methoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 158005504 |
| Molecular Formula | C62H112N16O20 |
| Molecular Weight | 1401.67 g/mol |
| Exact Mass | 1400.82 |
| IUPAC Name | methyl N-[(2S)-1-[[3-[bis[2-[(6-amino-5-methyl-6-oxohexyl)amino]-2-oxoethyl]amino]-3-oxopropyl]amino]-6-(methoxycarbonylamino)-1-oxohexan-2-yl]carbamate |
| SMILES | COC(=O)NCCCC[C@H](NC(=O)OC)C(=O)NCCC(=O)N(CC(=O)NCCCCC(C)C(N)=O)CC(=O)NCCCCC(C)C(N)=O.COC(=O)NCCCC[C@H](NC(=O)OC)C(=O)NCCC(=O)N(CC(=O)NCCCCC(C)C(N)=O)CC(=O)NCCCCC(C)C(N)=O |
| InChI | InChI=1S/2C31H56N8O10/c2*1-21(27(32)43)11-5-8-15-34-24(40)19-39(20-25(41)35-16-9-6-12-22(2)28(33)44)26(42)14-18-36-29(45)23(38-31(47)49-4)13-7-10-17-37-30(46)48-3/h2*21-23H,5-20H2,1-4H3,(H2,32,43)(H2,33,44)(H,34,40)(H,35,41)(H,36,45)(H,37,46)(H,38,47)/t2*21?,22?,23-/m00/s1 |
| InChIKey | FEFYZNXEOJXHMK-DLAFNAKASA-N |
| XLogP | -1.22 |
| TPSA | 540.90 Ų |
| H-Bond Donors | 14 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 52 |
| Heavy Atoms | 98 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1401.67 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 14 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|