C54H104N16O12 — CID 158594043
6-[[2-[3-acetamidopropanoyl-[2-[[6-amino-6-oxo-5-(propan-2-ylamino)hexyl]amino]-2-oxoethyl]amino]acetyl]amino]-2-(propan-2-ylamino)hexanamide (PubChem CID 158594043) has the molecular formula C54H104N16O12 and a molecular weight of 1169.53 g/mol. Its IUPAC name is 6-[[2-[3-acetamidopropanoyl-[2-[[6-amino-6-oxo-5-(propan-2-ylamino)hexyl]amino]-2-oxoethyl]amino]acetyl]amino]-2-(propan-2-ylamino)hexanamide.
| Compound Name | 6-[[2-[3-acetamidopropanoyl-[2-[[6-amino-6-oxo-5-(propan-2-ylamino)hexyl]amino]-2-oxoethyl]amino]acetyl]amino]-2-(propan-2-ylamino)hexanamide |
|---|---|
| PubChem CID | 158594043 |
| Molecular Formula | C54H104N16O12 |
| Molecular Weight | 1169.53 g/mol |
| Exact Mass | 1168.80 |
| IUPAC Name | 6-[[2-[3-acetamidopropanoyl-[2-[[6-amino-6-oxo-5-(propan-2-ylamino)hexyl]amino]-2-oxoethyl]amino]acetyl]amino]-2-(propan-2-ylamino)hexanamide |
| SMILES | CC(=O)NCCC(=O)N(CC(=O)NCCCCC(NC(C)C)C(N)=O)CC(=O)NCCCCC(NC(C)C)C(N)=O.CC(=O)NCCC(=O)N(CC(=O)NCCCCC(NC(C)C)C(N)=O)CC(=O)NCCCCC(NC(C)C)C(N)=O |
| InChI | InChI=1S/2C27H52N8O6/c2*1-18(2)33-21(26(28)40)10-6-8-13-31-23(37)16-35(25(39)12-15-30-20(5)36)17-24(38)32-14-9-7-11-22(27(29)41)34-19(3)4/h2*18-19,21-22,33-34H,6-17H2,1-5H3,(H2,28,40)(H2,29,41)(H,30,36)(H,31,37)(H,32,38) |
| InChIKey | HUUJSRMOBMFMGD-UHFFFAOYSA-N |
| XLogP | -2.76 |
| TPSA | 435.70 Ų |
| H-Bond Donors | 14 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1169.53 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 14 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|