C15H29N3O6 — CID 158264935
methyl N-[(5S)-11-aminooxy-1-(methoxycarbonylamino)-6-oxoundecan-5-yl]carbamate (PubChem CID 158264935) has the molecular formula C15H29N3O6 and a molecular weight of 347.41 g/mol. Its IUPAC name is methyl N-[(5S)-11-aminooxy-1-(methoxycarbonylamino)-6-oxoundecan-5-yl]carbamate.
| Compound Name | methyl N-[(5S)-11-aminooxy-1-(methoxycarbonylamino)-6-oxoundecan-5-yl]carbamate |
|---|---|
| PubChem CID | 158264935 |
| Molecular Formula | C15H29N3O6 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | methyl N-[(5S)-11-aminooxy-1-(methoxycarbonylamino)-6-oxoundecan-5-yl]carbamate |
| SMILES | COC(=O)NCCCC[C@H](NC(=O)OC)C(=O)CCCCCON |
| InChI | InChI=1S/C15H29N3O6/c1-22-14(20)17-10-6-5-8-12(18-15(21)23-2)13(19)9-4-3-7-11-24-16/h12H,3-11,16H2,1-2H3,(H,17,20)(H,18,21)/t12-/m0/s1 |
| InChIKey | GIHZWGHRKZOBAR-LBPRGKRZSA-N |
| XLogP | 1.26 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|