C24H33N5O8 — CID 158153023
cyclopent-4-ene-1,3-dione;2,6-diacetamido-N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]hexanamide (PubChem CID 158153023) has the molecular formula C24H33N5O8 and a molecular weight of 519.56 g/mol. Its IUPAC name is cyclopent-4-ene-1,3-dione;2,6-diacetamido-N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]hexanamide.
| Compound Name | cyclopent-4-ene-1,3-dione;2,6-diacetamido-N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]hexanamide |
|---|---|
| PubChem CID | 158153023 |
| Molecular Formula | C24H33N5O8 |
| Molecular Weight | 519.56 g/mol |
| Exact Mass | 519.23 |
| IUPAC Name | cyclopent-4-ene-1,3-dione;2,6-diacetamido-N-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethyl]hexanamide |
| SMILES | CC(=O)NCCCCC(NC(C)=O)C(=O)NCCNC(=O)CCN1C(=O)C=CC1=O.O=C1C=CC(=O)C1 |
| InChI | InChI=1S/C19H29N5O6.C5H4O2/c1-13(25)20-9-4-3-5-15(23-14(2)26)19(30)22-11-10-21-16(27)8-12-24-17(28)6-7-18(24)29;6-4-1-2-5(7)3-4/h6-7,15H,3-5,8-12H2,1-2H3,(H,20,25)(H,21,27)(H,22,30)(H,23,26);1-2H,3H2 |
| InChIKey | FVISOWRZKVUFHT-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 187.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.56 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|