C19H31N4O9P — CID 59523646
[3-acetamido-4-[[5-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethylamino]-5-oxopentyl]amino]-4-oxobutyl]phosphonic acid (PubChem CID 59523646) has the molecular formula C19H31N4O9P and a molecular weight of 490.45 g/mol. Its IUPAC name is [3-acetamido-4-[[5-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethylamino]-5-oxopentyl]amino]-4-oxobutyl]phosphonic acid.
| Compound Name | [3-acetamido-4-[[5-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethylamino]-5-oxopentyl]amino]-4-oxobutyl]phosphonic acid |
|---|---|
| PubChem CID | 59523646 |
| Molecular Formula | C19H31N4O9P |
| Molecular Weight | 490.45 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | [3-acetamido-4-[[5-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethylamino]-5-oxopentyl]amino]-4-oxobutyl]phosphonic acid |
| SMILES | CC(=O)NC(CCP(=O)(O)O)C(=O)NCCCCC(=O)NCCOCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C19H31N4O9P/c1-14(24)22-15(7-13-33(29,30)31)19(28)21-8-3-2-4-16(25)20-9-11-32-12-10-23-17(26)5-6-18(23)27/h5-6,15H,2-4,7-13H2,1H3,(H,20,25)(H,21,28)(H,22,24)(H2,29,30,31) |
| InChIKey | OBWZTUAAVMADKB-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 191.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.45 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|