C21H33N5O10 — CID 58480607
methoxymethyl N-[6-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-5-(2-hydroxyethoxycarbonylamino)-6-oxohexyl]carbamate (PubChem CID 58480607) has the molecular formula C21H33N5O10 and a molecular weight of 515.52 g/mol. Its IUPAC name is methoxymethyl N-[6-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-5-(2-hydroxyethoxycarbonylamino)-6-oxohexyl]carbamate.
| Compound Name | methoxymethyl N-[6-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-5-(2-hydroxyethoxycarbonylamino)-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 58480607 |
| Molecular Formula | C21H33N5O10 |
| Molecular Weight | 515.52 g/mol |
| Exact Mass | 515.22 |
| IUPAC Name | methoxymethyl N-[6-[2-[3-(2,5-dioxopyrrol-1-yl)propanoylamino]ethylamino]-5-(2-hydroxyethoxycarbonylamino)-6-oxohexyl]carbamate |
| SMILES | COCOC(=O)NCCCCC(NC(=O)OCCO)C(=O)NCCNC(=O)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C21H33N5O10/c1-34-14-36-20(32)24-8-3-2-4-15(25-21(33)35-13-12-27)19(31)23-10-9-22-16(28)7-11-26-17(29)5-6-18(26)30/h5-6,15,27H,2-4,7-14H2,1H3,(H,22,28)(H,23,31)(H,24,32)(H,25,33) |
| InChIKey | RWFKXHYXBKUFMW-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 201.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.52 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|