C12H27N3O — CID 159436243
N-(5-hydrazinylpentyl)-3,4-dimethylpentanamide (PubChem CID 159436243) has the molecular formula C12H27N3O and a molecular weight of 229.37 g/mol. Its IUPAC name is N-(5-hydrazinylpentyl)-3,4-dimethylpentanamide.
| Compound Name | N-(5-hydrazinylpentyl)-3,4-dimethylpentanamide |
|---|---|
| PubChem CID | 159436243 |
| Molecular Formula | C12H27N3O |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.22 |
| IUPAC Name | N-(5-hydrazinylpentyl)-3,4-dimethylpentanamide |
| SMILES | CC(C)C(C)CC(=O)NCCCCCNN |
| InChI | InChI=1S/C12H27N3O/c1-10(2)11(3)9-12(16)14-7-5-4-6-8-15-13/h10-11,15H,4-9,13H2,1-3H3,(H,14,16) |
| InChIKey | VLAOYJPHJCKDPE-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|