C23H46N2O3 — CID 58807800
8-(5-aminopentylamino)-4,4,5,5-tetramethyl-8-oxo-3,6-di(propan-2-yl)octanoic acid (PubChem CID 58807800) has the molecular formula C23H46N2O3 and a molecular weight of 398.63 g/mol. Its IUPAC name is 8-(5-aminopentylamino)-4,4,5,5-tetramethyl-8-oxo-3,6-di(propan-2-yl)octanoic acid.
| Compound Name | 8-(5-aminopentylamino)-4,4,5,5-tetramethyl-8-oxo-3,6-di(propan-2-yl)octanoic acid |
|---|---|
| PubChem CID | 58807800 |
| Molecular Formula | C23H46N2O3 |
| Molecular Weight | 398.63 g/mol |
| Exact Mass | 398.35 |
| IUPAC Name | 8-(5-aminopentylamino)-4,4,5,5-tetramethyl-8-oxo-3,6-di(propan-2-yl)octanoic acid |
| SMILES | CC(C)C(CC(=O)O)C(C)(C)C(C)(C)C(CC(=O)NCCCCCN)C(C)C |
| InChI | InChI=1S/C23H46N2O3/c1-16(2)18(14-20(26)25-13-11-9-10-12-24)22(5,6)23(7,8)19(17(3)4)15-21(27)28/h16-19H,9-15,24H2,1-8H3,(H,25,26)(H,27,28) |
| InChIKey | HZZHOBSXMYAYST-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.63 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|