C11H24N2O — CID 89281092
N-(7-aminoheptyl)-2-methylpropanamide (PubChem CID 89281092) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is N-(7-aminoheptyl)-2-methylpropanamide.
| Compound Name | N-(7-aminoheptyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 89281092 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | N-(7-aminoheptyl)-2-methylpropanamide |
| SMILES | CC(C)C(=O)NCCCCCCCN |
| InChI | InChI=1S/C11H24N2O/c1-10(2)11(14)13-9-7-5-3-4-6-8-12/h10H,3-9,12H2,1-2H3,(H,13,14) |
| InChIKey | MOMHKMCAPYFULY-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|