C6H13NO2 — CID 171076136
(2R)-N-hydroxy-N,2-dimethylbutanamide (PubChem CID 171076136) has the molecular formula C6H13NO2 and a molecular weight of 131.18 g/mol. Its IUPAC name is (2R)-N-hydroxy-N,2-dimethylbutanamide.
| Compound Name | (2R)-N-hydroxy-N,2-dimethylbutanamide |
|---|---|
| PubChem CID | 171076136 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | (2R)-N-hydroxy-N,2-dimethylbutanamide |
| SMILES | CC[C@@H](C)C(=O)N(C)O |
| InChI | InChI=1S/C6H13NO2/c1-4-5(2)6(8)7(3)9/h5,9H,4H2,1-3H3/t5-/m1/s1 |
| InChIKey | IHABNQYBSDMQFF-RXMQYKEDSA-N |
| XLogP | 0.88 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|