C10H18NOY- — CID 162288992
N-but-2-en-2-yl-N,2-dimethylbutanamide;yttrium (PubChem CID 162288992) has the molecular formula C10H18NOY- and a molecular weight of 257.17 g/mol. Its IUPAC name is N-but-2-en-2-yl-N,2-dimethylbutanamide;yttrium.
| Compound Name | N-but-2-en-2-yl-N,2-dimethylbutanamide;yttrium |
|---|---|
| PubChem CID | 162288992 |
| Molecular Formula | C10H18NOY- |
| Molecular Weight | 257.17 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | N-but-2-en-2-yl-N,2-dimethylbutanamide;yttrium |
| SMILES | C/[C-]=C(/C)N(C)C(=O)C(C)CC.[Y] |
| InChI | InChI=1S/C10H18NO.Y/c1-6-8(3)10(12)11(5)9(4)7-2;/h8H,6H2,1-5H3;/q-1; |
| InChIKey | ZGXTUKJTNGWVGX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.17 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|