C8H16BrNO — CID 80658346
N-(2-bromoethyl)-N,2-dimethylbutanamide (PubChem CID 80658346) has the molecular formula C8H16BrNO and a molecular weight of 222.13 g/mol. Its IUPAC name is N-(2-bromoethyl)-N,2-dimethylbutanamide.
| Compound Name | N-(2-bromoethyl)-N,2-dimethylbutanamide |
|---|---|
| PubChem CID | 80658346 |
| Molecular Formula | C8H16BrNO |
| Molecular Weight | 222.13 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | N-(2-bromoethyl)-N,2-dimethylbutanamide |
| SMILES | CCC(C)C(=O)N(C)CCBr |
| InChI | InChI=1S/C8H16BrNO/c1-4-7(2)8(11)10(3)6-5-9/h7H,4-6H2,1-3H3 |
| InChIKey | RVFWOYPPSJURIJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.13 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|