C15H22BrNO — CID 80658652
N-(2-bromoethyl)-N,3-dimethyl-2-phenylpentanamide (PubChem CID 80658652) has the molecular formula C15H22BrNO and a molecular weight of 312.25 g/mol. Its IUPAC name is N-(2-bromoethyl)-N,3-dimethyl-2-phenylpentanamide.
| Compound Name | N-(2-bromoethyl)-N,3-dimethyl-2-phenylpentanamide |
|---|---|
| PubChem CID | 80658652 |
| Molecular Formula | C15H22BrNO |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | N-(2-bromoethyl)-N,3-dimethyl-2-phenylpentanamide |
| SMILES | CCC(C)C(C(=O)N(C)CCBr)c1ccccc1 |
| InChI | InChI=1S/C15H22BrNO/c1-4-12(2)14(13-8-6-5-7-9-13)15(18)17(3)11-10-16/h5-9,12,14H,4,10-11H2,1-3H3 |
| InChIKey | MTLAAQPYRHOCAJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|