C16H23NO3 — CID 61021604
2-[ethyl-(3-methyl-2-phenylpentanoyl)amino]acetic acid (PubChem CID 61021604) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is 2-[ethyl-(3-methyl-2-phenylpentanoyl)amino]acetic acid.
| Compound Name | 2-[ethyl-(3-methyl-2-phenylpentanoyl)amino]acetic acid |
|---|---|
| PubChem CID | 61021604 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 2-[ethyl-(3-methyl-2-phenylpentanoyl)amino]acetic acid |
| SMILES | CCC(C)C(C(=O)N(CC)CC(=O)O)c1ccccc1 |
| InChI | InChI=1S/C16H23NO3/c1-4-12(3)15(13-9-7-6-8-10-13)16(20)17(5-2)11-14(18)19/h6-10,12,15H,4-5,11H2,1-3H3,(H,18,19) |
| InChIKey | RJBOUYJYDURZDI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |