About N-acetyl-N-methylacetamide;ethane;methane
N-acetyl-N-methylacetamide;ethane;methane (PubChem CID 158491582) has the molecular formula C11H29NO2
and a molecular weight of 207.36 g/mol. Its IUPAC name is N-acetyl-N-methylacetamide;ethane;methane.
Molecular Properties
| Compound Name | N-acetyl-N-methylacetamide;ethane;methane |
| PubChem CID | 158491582 |
| Molecular Formula | C11H29NO2 |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.22 |
| IUPAC Name | N-acetyl-N-methylacetamide;ethane;methane |
| SMILES | C.C.CC.CC.CC(=O)N(C)C(C)=O |
| InChI | InChI=1S/C5H9NO2.2C2H6.2CH4/c1-4(7)6(3)5(2)8;2*1-2;;/h1-3H3;2*1-2H3;2*1H4 |
| InChIKey | HITKCZBPBORTNR-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-acetyl-N-methylacetamide;ethane;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-acetyl-N-methylacetamide;ethane;methane?
The IUPAC name of N-acetyl-N-methylacetamide;ethane;methane (CID 158491582) is N-acetyl-N-methylacetamide;ethane;methane.
What is the SMILES notation for N-acetyl-N-methylacetamide;ethane;methane?
The canonical SMILES for N-acetyl-N-methylacetamide;ethane;methane is C.C.CC.CC.CC(=O)N(C)C(C)=O.
What is the InChIKey of N-acetyl-N-methylacetamide;ethane;methane?
The InChIKey is HITKCZBPBORTNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO2.2C2H6.2CH4/c1-4(7)6(3)5(2)8;2*1-2;;/h1-3H3;2*1-2H3;2*1H4.
What are the key properties of N-acetyl-N-methylacetamide;ethane;methane?
N-acetyl-N-methylacetamide;ethane;methane has a molecular weight of 207.36 g/mol, XLogP of 3.34, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-acetyl-N-methylacetamide;ethane;methane is sourced from PubChem (CID 158491582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).