C4H15N3O — CID 161145572
azane;N,N-dimethylacetamide (PubChem CID 161145572) has the molecular formula C4H15N3O and a molecular weight of 121.18 g/mol. Its IUPAC name is azane;N,N-dimethylacetamide.
| Compound Name | azane;N,N-dimethylacetamide |
|---|---|
| PubChem CID | 161145572 |
| Molecular Formula | C4H15N3O |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.12 |
| IUPAC Name | azane;N,N-dimethylacetamide |
| SMILES | CC(=O)N(C)C.N.N |
| InChI | InChI=1S/C4H9NO.2H3N/c1-4(6)5(2)3;;/h1-3H3;2*1H3 |
| InChIKey | DYYKAQQXWPDDCT-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |