About azane;N,N-dimethylacetamide
azane;N,N-dimethylacetamide (PubChem CID 161145572) has the molecular formula C4H15N3O
and a molecular weight of 121.18 g/mol. Its IUPAC name is azane;N,N-dimethylacetamide.
Molecular Properties
| Compound Name | azane;N,N-dimethylacetamide |
| PubChem CID | 161145572 |
| Molecular Formula | C4H15N3O |
| Molecular Weight | 121.18 g/mol |
| Exact Mass | 121.12 |
| IUPAC Name | azane;N,N-dimethylacetamide |
| SMILES | CC(=O)N(C)C.N.N |
| InChI | InChI=1S/C4H9NO.2H3N/c1-4(6)5(2)3;;/h1-3H3;2*1H3 |
| InChIKey | DYYKAQQXWPDDCT-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 121.18 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;N,N-dimethylacetamide?
The IUPAC name of azane;N,N-dimethylacetamide (CID 161145572) is azane;N,N-dimethylacetamide.
What is the SMILES notation for azane;N,N-dimethylacetamide?
The canonical SMILES for azane;N,N-dimethylacetamide is CC(=O)N(C)C.N.N.
What is the InChIKey of azane;N,N-dimethylacetamide?
The InChIKey is DYYKAQQXWPDDCT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.2H3N/c1-4(6)5(2)3;;/h1-3H3;2*1H3.
What are the key properties of azane;N,N-dimethylacetamide?
azane;N,N-dimethylacetamide has a molecular weight of 121.18 g/mol, XLogP of 0.42, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;N,N-dimethylacetamide is sourced from PubChem (CID 161145572), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).