About N,N-dimethylacetamide;permanganic acid
N,N-dimethylacetamide;permanganic acid (PubChem CID 174571384) has the molecular formula C4H10MnNO5
and a molecular weight of 207.06 g/mol. Its IUPAC name is N,N-dimethylacetamide;permanganic acid.
Molecular Properties
| Compound Name | N,N-dimethylacetamide;permanganic acid |
| PubChem CID | 174571384 |
| Molecular Formula | C4H10MnNO5 |
| Molecular Weight | 207.06 g/mol |
| Exact Mass | 206.99 |
| IUPAC Name | N,N-dimethylacetamide;permanganic acid |
| SMILES | CC(=O)N(C)C.O=[Mn](=O)(=O)O |
| InChI | InChI=1S/C4H9NO.Mn.H2O.3O/c1-4(6)5(2)3;;;;;/h1-3H3;;1H2;;;/q;+1;;;;/p-1 |
| InChIKey | JPKYUGLPOQRPBY-UHFFFAOYSA-M |
| XLogP | -0.82 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.06 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,N-dimethylacetamide;permanganic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylacetamide;permanganic acid?
The IUPAC name of N,N-dimethylacetamide;permanganic acid (CID 174571384) is N,N-dimethylacetamide;permanganic acid.
What is the SMILES notation for N,N-dimethylacetamide;permanganic acid?
The canonical SMILES for N,N-dimethylacetamide;permanganic acid is CC(=O)N(C)C.O=[Mn](=O)(=O)O.
What is the InChIKey of N,N-dimethylacetamide;permanganic acid?
The InChIKey is JPKYUGLPOQRPBY-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H9NO.Mn.H2O.3O/c1-4(6)5(2)3;;;;;/h1-3H3;;1H2;;;/q;+1;;;;/p-1.
What are the key properties of N,N-dimethylacetamide;permanganic acid?
N,N-dimethylacetamide;permanganic acid has a molecular weight of 207.06 g/mol, XLogP of -0.82, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylacetamide;permanganic acid is sourced from PubChem (CID 174571384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).