N,N-dimethylacetamide;permanganic acid

C4H10MnNO5 — CID 174571384

IUPACN,N-dimethylacetamide;permanganic acid
SMILESCC(=O)N(C)C.O=[Mn](=O)(=O)O
InChIInChI=1S/C4H9NO.Mn.H2O.3O/c1-4(6)5(2)3;;;;;/h1-3H3;;1H2;;;/q;+1;;;;/p-1
InChIKeyJPKYUGLPOQRPBY-UHFFFAOYSA-M
MW207.06 g/mol
LogP-0.82
Rot. Bonds

About N,N-dimethylacetamide;permanganic acid

N,N-dimethylacetamide;permanganic acid (PubChem CID 174571384) has the molecular formula C4H10MnNO5 and a molecular weight of 207.06 g/mol. Its IUPAC name is N,N-dimethylacetamide;permanganic acid.

Molecular Properties

Compound NameN,N-dimethylacetamide;permanganic acid
PubChem CID174571384
Molecular FormulaC4H10MnNO5
Molecular Weight207.06 g/mol
Exact Mass206.99
IUPAC NameN,N-dimethylacetamide;permanganic acid
SMILESCC(=O)N(C)C.O=[Mn](=O)(=O)O
InChIInChI=1S/C4H9NO.Mn.H2O.3O/c1-4(6)5(2)3;;;;;/h1-3H3;;1H2;;;/q;+1;;;;/p-1
InChIKeyJPKYUGLPOQRPBY-UHFFFAOYSA-M
XLogP-0.82
TPSA91.75 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.06
LogP ≤ 5-0.82
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze N,N-dimethylacetamide;permanganic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N-dimethylacetamide;permanganic acid?
The IUPAC name of N,N-dimethylacetamide;permanganic acid (CID 174571384) is N,N-dimethylacetamide;permanganic acid.
What is the SMILES notation for N,N-dimethylacetamide;permanganic acid?
The canonical SMILES for N,N-dimethylacetamide;permanganic acid is CC(=O)N(C)C.O=[Mn](=O)(=O)O.
What is the InChIKey of N,N-dimethylacetamide;permanganic acid?
The InChIKey is JPKYUGLPOQRPBY-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H9NO.Mn.H2O.3O/c1-4(6)5(2)3;;;;;/h1-3H3;;1H2;;;/q;+1;;;;/p-1.
What are the key properties of N,N-dimethylacetamide;permanganic acid?
N,N-dimethylacetamide;permanganic acid has a molecular weight of 207.06 g/mol, XLogP of -0.82, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylacetamide;permanganic acid is sourced from PubChem (CID 174571384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).