About N,N-dimethylacetamide;ethane-1,2-diol
N,N-dimethylacetamide;ethane-1,2-diol (PubChem CID 19046924) has the molecular formula C6H15NO3
and a molecular weight of 149.19 g/mol. Its IUPAC name is N,N-dimethylacetamide;ethane-1,2-diol.
Molecular Properties
| Compound Name | N,N-dimethylacetamide;ethane-1,2-diol |
| PubChem CID | 19046924 |
| Molecular Formula | C6H15NO3 |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.11 |
| IUPAC Name | N,N-dimethylacetamide;ethane-1,2-diol |
| SMILES | CC(=O)N(C)C.OCCO |
| InChI | InChI=1S/C4H9NO.C2H6O2/c1-4(6)5(2)3;3-1-2-4/h1-3H3;3-4H,1-2H2 |
| InChIKey | OMSSPIJADYVUAT-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-dimethylacetamide;ethane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylacetamide;ethane-1,2-diol?
The IUPAC name of N,N-dimethylacetamide;ethane-1,2-diol (CID 19046924) is N,N-dimethylacetamide;ethane-1,2-diol.
What is the SMILES notation for N,N-dimethylacetamide;ethane-1,2-diol?
The canonical SMILES for N,N-dimethylacetamide;ethane-1,2-diol is CC(=O)N(C)C.OCCO.
What is the InChIKey of N,N-dimethylacetamide;ethane-1,2-diol?
The InChIKey is OMSSPIJADYVUAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.C2H6O2/c1-4(6)5(2)3;3-1-2-4/h1-3H3;3-4H,1-2H2.
What are the key properties of N,N-dimethylacetamide;ethane-1,2-diol?
N,N-dimethylacetamide;ethane-1,2-diol has a molecular weight of 149.19 g/mol, XLogP of -0.93, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylacetamide;ethane-1,2-diol is sourced from PubChem (CID 19046924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).