C6H15NO3 — CID 19046924
N,N-dimethylacetamide;ethane-1,2-diol (PubChem CID 19046924) has the molecular formula C6H15NO3 and a molecular weight of 149.19 g/mol. Its IUPAC name is N,N-dimethylacetamide;ethane-1,2-diol.
| Compound Name | N,N-dimethylacetamide;ethane-1,2-diol |
|---|---|
| PubChem CID | 19046924 |
| Molecular Formula | C6H15NO3 |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.11 |
| IUPAC Name | N,N-dimethylacetamide;ethane-1,2-diol |
| SMILES | CC(=O)N(C)C.OCCO |
| InChI | InChI=1S/C4H9NO.C2H6O2/c1-4(6)5(2)3;3-1-2-4/h1-3H3;3-4H,1-2H2 |
| InChIKey | OMSSPIJADYVUAT-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |