About lithium;N,N-dimethylacetamide;chloride
lithium;N,N-dimethylacetamide;chloride (PubChem CID 87129072) has the molecular formula C4H9ClLiNO
and a molecular weight of 129.52 g/mol. Its IUPAC name is lithium;N,N-dimethylacetamide;chloride.
Molecular Properties
| Compound Name | lithium;N,N-dimethylacetamide;chloride |
| PubChem CID | 87129072 |
| Molecular Formula | C4H9ClLiNO |
| Molecular Weight | 129.52 g/mol |
| Exact Mass | 129.05 |
| IUPAC Name | lithium;N,N-dimethylacetamide;chloride |
| SMILES | CC(=O)N(C)C.[Cl-].[Li+] |
| InChI | InChI=1S/C4H9NO.ClH.Li/c1-4(6)5(2)3;;/h1-3H3;1H;/q;;+1/p-1 |
| InChIKey | YPJJABHAGGFGAM-UHFFFAOYSA-M |
| XLogP | -5.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.52 |
| LogP ≤ 5 | -5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze lithium;N,N-dimethylacetamide;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;N,N-dimethylacetamide;chloride?
The IUPAC name of lithium;N,N-dimethylacetamide;chloride (CID 87129072) is lithium;N,N-dimethylacetamide;chloride.
What is the SMILES notation for lithium;N,N-dimethylacetamide;chloride?
The canonical SMILES for lithium;N,N-dimethylacetamide;chloride is CC(=O)N(C)C.[Cl-].[Li+].
What is the InChIKey of lithium;N,N-dimethylacetamide;chloride?
The InChIKey is YPJJABHAGGFGAM-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H9NO.ClH.Li/c1-4(6)5(2)3;;/h1-3H3;1H;/q;;+1/p-1.
What are the key properties of lithium;N,N-dimethylacetamide;chloride?
lithium;N,N-dimethylacetamide;chloride has a molecular weight of 129.52 g/mol, XLogP of -5.90, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;N,N-dimethylacetamide;chloride is sourced from PubChem (CID 87129072), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).