C5H11NO2 — CID 54040691
N,N-dimethylacetamide;formaldehyde (PubChem CID 54040691) has the molecular formula C5H11NO2 and a molecular weight of 117.15 g/mol. Its IUPAC name is N,N-dimethylacetamide;formaldehyde.
| Compound Name | N,N-dimethylacetamide;formaldehyde |
|---|---|
| PubChem CID | 54040691 |
| Molecular Formula | C5H11NO2 |
| Molecular Weight | 117.15 g/mol |
| Exact Mass | 117.08 |
| IUPAC Name | N,N-dimethylacetamide;formaldehyde |
| SMILES | C=O.CC(=O)N(C)C |
| InChI | InChI=1S/C4H9NO.CH2O/c1-4(6)5(2)3;1-2/h1-3H3;1H2 |
| InChIKey | LMCJCOHCSDHCAH-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 117.15 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |