About N,N-dimethylacetamide;methylsulfinylmethane;hydrate
N,N-dimethylacetamide;methylsulfinylmethane;hydrate (PubChem CID 19812504) has the molecular formula C6H17NO3S
and a molecular weight of 183.27 g/mol. Its IUPAC name is N,N-dimethylacetamide;methylsulfinylmethane;hydrate.
Molecular Properties
| Compound Name | N,N-dimethylacetamide;methylsulfinylmethane;hydrate |
| PubChem CID | 19812504 |
| Molecular Formula | C6H17NO3S |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | N,N-dimethylacetamide;methylsulfinylmethane;hydrate |
| SMILES | CC(=O)N(C)C.CS(C)=O.O |
| InChI | InChI=1S/C4H9NO.C2H6OS.H2O/c1-4(6)5(2)3;1-4(2)3;/h1-3H3;1-2H3;1H2 |
| InChIKey | MUPGEKCXQAOWCJ-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 68.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N,N-dimethylacetamide;methylsulfinylmethane;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylacetamide;methylsulfinylmethane;hydrate?
The IUPAC name of N,N-dimethylacetamide;methylsulfinylmethane;hydrate (CID 19812504) is N,N-dimethylacetamide;methylsulfinylmethane;hydrate.
What is the SMILES notation for N,N-dimethylacetamide;methylsulfinylmethane;hydrate?
The canonical SMILES for N,N-dimethylacetamide;methylsulfinylmethane;hydrate is CC(=O)N(C)C.CS(C)=O.O.
What is the InChIKey of N,N-dimethylacetamide;methylsulfinylmethane;hydrate?
The InChIKey is MUPGEKCXQAOWCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.C2H6OS.H2O/c1-4(6)5(2)3;1-4(2)3;/h1-3H3;1-2H3;1H2.
What are the key properties of N,N-dimethylacetamide;methylsulfinylmethane;hydrate?
N,N-dimethylacetamide;methylsulfinylmethane;hydrate has a molecular weight of 183.27 g/mol, XLogP of -0.74, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylacetamide;methylsulfinylmethane;hydrate is sourced from PubChem (CID 19812504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).