C6H9N3O — CID 174761763
N,N-dimethylacetamide;oxalonitrile (PubChem CID 174761763) has the molecular formula C6H9N3O and a molecular weight of 139.16 g/mol. Its IUPAC name is N,N-dimethylacetamide;oxalonitrile.
| Compound Name | N,N-dimethylacetamide;oxalonitrile |
|---|---|
| PubChem CID | 174761763 |
| Molecular Formula | C6H9N3O |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.07 |
| IUPAC Name | N,N-dimethylacetamide;oxalonitrile |
| SMILES | CC(=O)N(C)C.N#CC#N |
| InChI | InChI=1S/C4H9NO.C2N2/c1-4(6)5(2)3;3-1-2-4/h1-3H3; |
| InChIKey | HQALXFZLXCHKET-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |