About N,N-dimethylacetamide;molecular iodine
N,N-dimethylacetamide;molecular iodine (PubChem CID 158534416) has the molecular formula C4H9I2NO
and a molecular weight of 340.93 g/mol. Its IUPAC name is N,N-dimethylacetamide;molecular iodine.
Molecular Properties
| Compound Name | N,N-dimethylacetamide;molecular iodine |
| PubChem CID | 158534416 |
| Molecular Formula | C4H9I2NO |
| Molecular Weight | 340.93 g/mol |
| Exact Mass | 340.88 |
| IUPAC Name | N,N-dimethylacetamide;molecular iodine |
| SMILES | CC(=O)N(C)C.II |
| InChI | InChI=1S/C4H9NO.I2/c1-4(6)5(2)3;1-2/h1-3H3; |
| InChIKey | HNTQEFRIFOLRPI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.93 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylacetamide;molecular iodine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylacetamide;molecular iodine?
The IUPAC name of N,N-dimethylacetamide;molecular iodine (CID 158534416) is N,N-dimethylacetamide;molecular iodine.
What is the SMILES notation for N,N-dimethylacetamide;molecular iodine?
The canonical SMILES for N,N-dimethylacetamide;molecular iodine is CC(=O)N(C)C.II.
What is the InChIKey of N,N-dimethylacetamide;molecular iodine?
The InChIKey is HNTQEFRIFOLRPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.I2/c1-4(6)5(2)3;1-2/h1-3H3;.
What are the key properties of N,N-dimethylacetamide;molecular iodine?
N,N-dimethylacetamide;molecular iodine has a molecular weight of 340.93 g/mol, XLogP of 1.87, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylacetamide;molecular iodine is sourced from PubChem (CID 158534416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).