C12H27NO6 — CID 175584179
N,N-dimethylacetamide;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol (PubChem CID 175584179) has the molecular formula C12H27NO6 and a molecular weight of 281.35 g/mol. Its IUPAC name is N,N-dimethylacetamide;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol.
| Compound Name | N,N-dimethylacetamide;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 175584179 |
| Molecular Formula | C12H27NO6 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.18 |
| IUPAC Name | N,N-dimethylacetamide;2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethanol |
| SMILES | CC(=O)N(C)C.OCCOCCOCCOCCO |
| InChI | InChI=1S/C8H18O5.C4H9NO/c9-1-3-11-5-7-13-8-6-12-4-2-10;1-4(6)5(2)3/h9-10H,1-8H2;1-3H3 |
| InChIKey | LGPHXMGRSKOERL-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|