About acetic acid;manganese;permanganic acid
acetic acid;manganese;permanganic acid (PubChem CID 174607750) has the molecular formula C2H5Mn2O6
and a molecular weight of 234.93 g/mol. Its IUPAC name is acetic acid;manganese;permanganic acid.
Molecular Properties
| Compound Name | acetic acid;manganese;permanganic acid |
| PubChem CID | 174607750 |
| Molecular Formula | C2H5Mn2O6 |
| Molecular Weight | 234.93 g/mol |
| Exact Mass | 234.88 |
| IUPAC Name | acetic acid;manganese;permanganic acid |
| SMILES | CC(=O)O.O=[Mn](=O)(=O)O.[Mn] |
| InChI | InChI=1S/C2H4O2.2Mn.H2O.3O/c1-2(3)4;;;;;;/h1H3,(H,3,4);;;1H2;;;/q;;+1;;;;/p-1 |
| InChIKey | HTBRCRUPHWOLKX-UHFFFAOYSA-M |
| XLogP | -0.83 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.93 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze acetic acid;manganese;permanganic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;manganese;permanganic acid?
The IUPAC name of acetic acid;manganese;permanganic acid (CID 174607750) is acetic acid;manganese;permanganic acid.
What is the SMILES notation for acetic acid;manganese;permanganic acid?
The canonical SMILES for acetic acid;manganese;permanganic acid is CC(=O)O.O=[Mn](=O)(=O)O.[Mn].
What is the InChIKey of acetic acid;manganese;permanganic acid?
The InChIKey is HTBRCRUPHWOLKX-UHFFFAOYSA-M. The full InChI is InChI=1S/C2H4O2.2Mn.H2O.3O/c1-2(3)4;;;;;;/h1H3,(H,3,4);;;1H2;;;/q;;+1;;;;/p-1.
What are the key properties of acetic acid;manganese;permanganic acid?
acetic acid;manganese;permanganic acid has a molecular weight of 234.93 g/mol, XLogP of -0.83, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;manganese;permanganic acid is sourced from PubChem (CID 174607750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).