C18H29NO2 — CID 158828106
(2E,4E,6R,8Z,10E,12R)-N-methoxy-N,6,12-trimethyltetradeca-2,4,8,10-tetraenamide (PubChem CID 158828106) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is (2E,4E,6R,8Z,10E,12R)-N-methoxy-N,6,12-trimethyltetradeca-2,4,8,10-tetraenamide.
| Compound Name | (2E,4E,6R,8Z,10E,12R)-N-methoxy-N,6,12-trimethyltetradeca-2,4,8,10-tetraenamide |
|---|---|
| PubChem CID | 158828106 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | (2E,4E,6R,8Z,10E,12R)-N-methoxy-N,6,12-trimethyltetradeca-2,4,8,10-tetraenamide |
| SMILES | CC[C@@H](C)/C=C/C=C\C[C@@H](C)/C=C/C=C/C(=O)N(C)OC |
| InChI | InChI=1S/C18H29NO2/c1-6-16(2)12-8-7-9-13-17(3)14-10-11-15-18(20)19(4)21-5/h7-12,14-17H,6,13H2,1-5H3/b9-7-,12-8+,14-10+,15-11+/t16-,17-/m1/s1 |
| InChIKey | NACWEAVCBWNMBF-PPCHKXEHSA-N |
| XLogP | 4.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|