C11H21NO3 — CID 10036225
(E,4S,5S)-5-hydroxy-N-methoxy-N,4,6-trimethylhept-2-enamide (PubChem CID 10036225) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is (E,4S,5S)-5-hydroxy-N-methoxy-N,4,6-trimethylhept-2-enamide.
| Compound Name | (E,4S,5S)-5-hydroxy-N-methoxy-N,4,6-trimethylhept-2-enamide |
|---|---|
| PubChem CID | 10036225 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | (E,4S,5S)-5-hydroxy-N-methoxy-N,4,6-trimethylhept-2-enamide |
| SMILES | CON(C)C(=O)/C=C/[C@H](C)[C@@H](O)C(C)C |
| InChI | InChI=1S/C11H21NO3/c1-8(2)11(14)9(3)6-7-10(13)12(4)15-5/h6-9,11,14H,1-5H3/b7-6+/t9-,11-/m0/s1 |
| InChIKey | KKLBZELBGRZGDT-BZGQNNPNSA-N |
| XLogP | 1.22 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|