C10H17NO3 — CID 88883922
(2E,6E)-8-hydroxy-N-methoxy-N-methylocta-2,6-dienamide (PubChem CID 88883922) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is (2E,6E)-8-hydroxy-N-methoxy-N-methylocta-2,6-dienamide.
| Compound Name | (2E,6E)-8-hydroxy-N-methoxy-N-methylocta-2,6-dienamide |
|---|---|
| PubChem CID | 88883922 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | (2E,6E)-8-hydroxy-N-methoxy-N-methylocta-2,6-dienamide |
| SMILES | CON(C)C(=O)/C=C/CC/C=C/CO |
| InChI | InChI=1S/C10H17NO3/c1-11(14-2)10(13)8-6-4-3-5-7-9-12/h5-8,12H,3-4,9H2,1-2H3/b7-5+,8-6+ |
| InChIKey | UPSFVQUNCBAEBQ-KQQUZDAGSA-N |
| XLogP | 0.89 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|