C11H18INO2 — CID 89219272
(2E,6E)-9-iodo-N-methoxy-N-methylnona-2,6-dienamide (PubChem CID 89219272) has the molecular formula C11H18INO2 and a molecular weight of 323.17 g/mol. Its IUPAC name is (2E,6E)-9-iodo-N-methoxy-N-methylnona-2,6-dienamide.
| Compound Name | (2E,6E)-9-iodo-N-methoxy-N-methylnona-2,6-dienamide |
|---|---|
| PubChem CID | 89219272 |
| Molecular Formula | C11H18INO2 |
| Molecular Weight | 323.17 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | (2E,6E)-9-iodo-N-methoxy-N-methylnona-2,6-dienamide |
| SMILES | CON(C)C(=O)/C=C/CC/C=C/CCI |
| InChI | InChI=1S/C11H18INO2/c1-13(15-2)11(14)9-7-5-3-4-6-8-10-12/h4,6-7,9H,3,5,8,10H2,1-2H3/b6-4+,9-7+ |
| InChIKey | LWICDLDWJUHNPQ-ADIUVMHLSA-N |
| XLogP | 2.72 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.17 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|