C17H28INO2 — CID 50901540
(2E,6E,10E)-12-iodo-N-methoxy-N,3,7,11-tetramethyldodeca-2,6,10-trienamide (PubChem CID 50901540) has the molecular formula C17H28INO2 and a molecular weight of 405.32 g/mol. Its IUPAC name is (2E,6E,10E)-12-iodo-N-methoxy-N,3,7,11-tetramethyldodeca-2,6,10-trienamide.
| Compound Name | (2E,6E,10E)-12-iodo-N-methoxy-N,3,7,11-tetramethyldodeca-2,6,10-trienamide |
|---|---|
| PubChem CID | 50901540 |
| Molecular Formula | C17H28INO2 |
| Molecular Weight | 405.32 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | (2E,6E,10E)-12-iodo-N-methoxy-N,3,7,11-tetramethyldodeca-2,6,10-trienamide |
| SMILES | CON(C)C(=O)/C=C(\C)CC/C=C(\C)CC/C=C(\C)CI |
| InChI | InChI=1S/C17H28INO2/c1-14(9-7-11-16(3)13-18)8-6-10-15(2)12-17(20)19(4)21-5/h8,11-12H,6-7,9-10,13H2,1-5H3/b14-8+,15-12+,16-11+ |
| InChIKey | VZGSSEIZHAOKQQ-RKGBGRRTSA-N |
| XLogP | 4.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.32 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|