C13H20O4 — CID 162814763
10-methoxy-3,7-dimethyl-10-oxodeca-2,6-dienoic acid (PubChem CID 162814763) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is 10-methoxy-3,7-dimethyl-10-oxodeca-2,6-dienoic acid.
| Compound Name | 10-methoxy-3,7-dimethyl-10-oxodeca-2,6-dienoic acid |
|---|---|
| PubChem CID | 162814763 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 10-methoxy-3,7-dimethyl-10-oxodeca-2,6-dienoic acid |
| SMILES | COC(=O)CCC(C)=CCCC(C)=CC(=O)O |
| InChI | InChI=1S/C13H20O4/c1-10(7-8-13(16)17-3)5-4-6-11(2)9-12(14)15/h5,9H,4,6-8H2,1-3H3,(H,14,15) |
| InChIKey | YGMFRMJDLJQZDH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|