10-methoxy-3,7-dimethyl-10-oxodeca-2,6-dienoic acid

C13H20O4 — CID 162814763

IUPAC10-methoxy-3,7-dimethyl-10-oxodeca-2,6-dienoic acid
SMILESCOC(=O)CCC(C)=CCCC(C)=CC(=O)O
InChIInChI=1S/C13H20O4/c1-10(7-8-13(16)17-3)5-4-6-11(2)9-12(14)15/h5,9H,4,6-8H2,1-3H3,(H,14,15)
InChIKeyYGMFRMJDLJQZDH-UHFFFAOYSA-N
MW240.30 g/mol
LogP2.70
Rot. Bonds7

About 10-methoxy-3,7-dimethyl-10-oxodeca-2,6-dienoic acid

10-methoxy-3,7-dimethyl-10-oxodeca-2,6-dienoic acid (PubChem CID 162814763) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is 10-methoxy-3,7-dimethyl-10-oxodeca-2,6-dienoic acid.

Molecular Properties

Compound Name10-methoxy-3,7-dimethyl-10-oxodeca-2,6-dienoic acid
PubChem CID162814763
Molecular FormulaC13H20O4
Molecular Weight240.30 g/mol
Exact Mass240.14
IUPAC Name10-methoxy-3,7-dimethyl-10-oxodeca-2,6-dienoic acid
SMILESCOC(=O)CCC(C)=CCCC(C)=CC(=O)O
InChIInChI=1S/C13H20O4/c1-10(7-8-13(16)17-3)5-4-6-11(2)9-12(14)15/h5,9H,4,6-8H2,1-3H3,(H,14,15)
InChIKeyYGMFRMJDLJQZDH-UHFFFAOYSA-N
XLogP2.70
TPSA63.60 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.30
LogP ≤ 52.70
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 10-methoxy-3,7-dimethyl-10-oxodeca-2,6-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 10-methoxy-3,7-dimethyl-10-oxodeca-2,6-dienoic acid?
The IUPAC name of 10-methoxy-3,7-dimethyl-10-oxodeca-2,6-dienoic acid (CID 162814763) is 10-methoxy-3,7-dimethyl-10-oxodeca-2,6-dienoic acid.
What is the SMILES notation for 10-methoxy-3,7-dimethyl-10-oxodeca-2,6-dienoic acid?
The canonical SMILES for 10-methoxy-3,7-dimethyl-10-oxodeca-2,6-dienoic acid is COC(=O)CCC(C)=CCCC(C)=CC(=O)O.
What is the InChIKey of 10-methoxy-3,7-dimethyl-10-oxodeca-2,6-dienoic acid?
The InChIKey is YGMFRMJDLJQZDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O4/c1-10(7-8-13(16)17-3)5-4-6-11(2)9-12(14)15/h5,9H,4,6-8H2,1-3H3,(H,14,15).
What are the key properties of 10-methoxy-3,7-dimethyl-10-oxodeca-2,6-dienoic acid?
10-methoxy-3,7-dimethyl-10-oxodeca-2,6-dienoic acid has a molecular weight of 240.30 g/mol, XLogP of 2.70, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10-methoxy-3,7-dimethyl-10-oxodeca-2,6-dienoic acid is sourced from PubChem (CID 162814763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).